2-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]acetonitrile
Modify Date: 2025-11-30 13:52:30
![2-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]acetonitrile Structure](https://image.chemsrc.com/caspic/089/42780-50-7.png)
2-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]acetonitrile structure
|
Common Name | 2-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]acetonitrile | ||
|---|---|---|---|---|
| CAS Number | 42780-50-7 | Molecular Weight | 224.30100 | |
| Density | 1.01g/cm3 | Boiling Point | 385.2ºC at 760mmHg | |
| Molecular Formula | C15H16N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.7ºC | |
| Name | 2-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]acetonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.01g/cm3 |
|---|---|
| Boiling Point | 385.2ºC at 760mmHg |
| Molecular Formula | C15H16N2 |
| Molecular Weight | 224.30100 |
| Flash Point | 186.7ºC |
| Exact Mass | 224.13100 |
| PSA | 28.72000 |
| LogP | 3.46858 |
| Index of Refraction | 1.56 |
| InChIKey | OMOHSRIDEFLEOH-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-n2c(C)cc(CC#N)c2C)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,4-dimethyl-1-nitroso-1,2,3,4-tetrahydroquinoxaline |
| hms1735d03 |