H-Arg-Arg-4MβNA · 3 HCl
Modify Date: 2025-08-27 01:05:56
H-Arg-Arg-4MβNA · 3 HCl structure
|
Common Name | H-Arg-Arg-4MβNA · 3 HCl | ||
|---|---|---|---|---|
| CAS Number | 42761-77-3 | Molecular Weight | 485.58300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H35N9O3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS08 |
Signal Word | Warning | |
| Name | 2-amino-5-(diaminomethylideneamino)-N-[5-(diaminomethylideneamino)-1-[(4-methoxynaphthalen-2-yl)amino]-1-oxopentan-2-yl]pentanamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H35N9O3 |
|---|---|
| Molecular Weight | 485.58300 |
| Exact Mass | 485.28600 |
| PSA | 224.23000 |
| LogP | 4.69750 |
| InChIKey | SYEDKPVXKRDNKP-UHFFFAOYSA-N |
| SMILES | COc1cc(NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CCCN=C(N)N)cc2ccccc12 |
| Symbol |
GHS08 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H351 |
| Precautionary Statements | P281 |
| Personal Protective Equipment | Eyeshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | 40 |
| Safety Phrases | 22-36 |
| RIDADR | NONH for all modes of transport |
|
Smith, R.E. et al.
Lysosomes in Biology and Pathology , (1975) 4 , 193
|
| Arg-Arg-4-Methoxy-2-Naphthylamine |
| RR-MNA |
| MNA038 |
| Arg-Arg 4-methoxy-|A-naphthylamide trihydrochloride |
| Arg-Arg-MNA |