1-Cyclohexene-1-propanenitrile,2-chloro-4-methyl-6-oxo- structure
|
Common Name | 1-Cyclohexene-1-propanenitrile,2-chloro-4-methyl-6-oxo- | ||
|---|---|---|---|---|
| CAS Number | 42747-36-4 | Molecular Weight | 197.66100 | |
| Density | 1.15g/cm3 | Boiling Point | 346.8ºC at 760mmHg | |
| Molecular Formula | C10H12ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.6ºC | |
| Name | 3-(2-chloro-4-methyl-6-oxocyclohexen-1-yl)propanenitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 346.8ºC at 760mmHg |
| Molecular Formula | C10H12ClNO |
| Molecular Weight | 197.66100 |
| Flash Point | 163.6ºC |
| Exact Mass | 197.06100 |
| PSA | 40.86000 |
| LogP | 2.78208 |
| Index of Refraction | 1.502 |
| InChIKey | QUNJGNZZVCWAIQ-UHFFFAOYSA-N |
| SMILES | CC1CC(=O)C(CCC#N)=C(Cl)C1 |
|
~%
1-Cyclohexene-1... CAS#:42747-36-4 |
| Literature: Clark,R.D.; Heathcock,C.H. Journal of Organic Chemistry, 1976 , vol. 41, p. 636 - 643 |
| 2-chloro-4-methyl-6-oxo-1-cyclohexene-1-propanenitrile |