1,2,3,4-tetrachloro-5-(2,4,6-trichloro-3-nitrophenyl)benzene
Modify Date: 2025-09-22 19:04:55
1,2,3,4-tetrachloro-5-(2,4,6-trichloro-3-nitrophenyl)benzene structure
|
Common Name | 1,2,3,4-tetrachloro-5-(2,4,6-trichloro-3-nitrophenyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 42740-49-8 | Molecular Weight | 440.32100 | |
| Density | 1.759g/cm3 | Boiling Point | 467.8ºC at 760 mmHg | |
| Molecular Formula | C12H2Cl7NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.7ºC | |
| Name | 1,2,3,4-tetrachloro-5-(2,4,6-trichloro-3-nitrophenyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.759g/cm3 |
|---|---|
| Boiling Point | 467.8ºC at 760 mmHg |
| Molecular Formula | C12H2Cl7NO2 |
| Molecular Weight | 440.32100 |
| Flash Point | 236.7ºC |
| Exact Mass | 436.79100 |
| PSA | 45.82000 |
| LogP | 8.35880 |
| Index of Refraction | 1.653 |
| InChIKey | RKPGEDPQBPEEDV-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1c(Cl)cc(Cl)c(-c2cc(Cl)c(Cl)c(Cl)c2Cl)c1Cl |
| HS Code | 2904909090 |
|---|
|
~%
1,2,3,4-tetrach... CAS#:42740-49-8 |
| Literature: Sundstroem,G. Acta Chemica Scandinavica (1947-1973), 1973 , vol. 27, p. 1109 - 1111 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2,2',3,4,4',5,6'-Heptachloro-3'-nitro-1,1'-biphenyl |
| 1,1'-Biphenyl,2,2',3,4,4',5,6'-heptachloro-3'-nitro |
| 3-Nitro-2,2',3',4,4',5',6-heptachlorobiphenyl |