methyl 2-[(C-methyl-N-tert-butyl-carbonimidoyl)amino]benzoate
Modify Date: 2024-11-30 12:50:59
![methyl 2-[(C-methyl-N-tert-butyl-carbonimidoyl)amino]benzoate Structure](https://image.chemsrc.com/caspic/443/42717-46-4.png)
methyl 2-[(C-methyl-N-tert-butyl-carbonimidoyl)amino]benzoate structure
|
Common Name | methyl 2-[(C-methyl-N-tert-butyl-carbonimidoyl)amino]benzoate | ||
|---|---|---|---|---|
| CAS Number | 42717-46-4 | Molecular Weight | 248.32100 | |
| Density | 1.01g/cm3 | Boiling Point | 377.1ºC at 760 mmHg | |
| Molecular Formula | C14H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.8ºC | |
| Name | methyl 2-[(N-tert-butyl-C-methylcarbonimidoyl)amino]benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.01g/cm3 |
|---|---|
| Boiling Point | 377.1ºC at 760 mmHg |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.32100 |
| Flash Point | 181.8ºC |
| Exact Mass | 248.15200 |
| PSA | 50.69000 |
| LogP | 3.17500 |
| Index of Refraction | 1.506 |
| InChIKey | SFEXDZYRKIEEAW-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccccc1NC(C)=NC(C)(C)C |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| methyl 2-[(c-methyl-n-tert-butyl-carbonimidoyl)amino]benzoate |