1-(4-nitrophenyl)-2-propan-2-yloxycarbothioylsulfanyl-ethanone
Modify Date: 2025-09-27 12:46:44
1-(4-nitrophenyl)-2-propan-2-yloxycarbothioylsulfanyl-ethanone structure
|
Common Name | 1-(4-nitrophenyl)-2-propan-2-yloxycarbothioylsulfanyl-ethanone | ||
|---|---|---|---|---|
| CAS Number | 42574-12-9 | Molecular Weight | 299.36600 | |
| Density | 1.333g/cm3 | Boiling Point | 440.5ºC at 760 mmHg | |
| Molecular Formula | C12H13NO4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.2ºC | |
| Name | O-propan-2-yl [2-(4-nitrophenyl)-2-oxoethyl]sulfanylmethanethioate |
|---|
| Density | 1.333g/cm3 |
|---|---|
| Boiling Point | 440.5ºC at 760 mmHg |
| Molecular Formula | C12H13NO4S2 |
| Molecular Weight | 299.36600 |
| Flash Point | 220.2ºC |
| Exact Mass | 299.02900 |
| PSA | 129.51000 |
| LogP | 3.74380 |
| Index of Refraction | 1.614 |
| InChIKey | UJANSKYAIWAUJB-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=S)SCC(=O)c1ccc([N+](=O)[O-])cc1 |
|
~%
1-(4-nitropheny... CAS#:42574-12-9 |
| Literature: Bhattacharya,A.K.; Hortmann,A.G. Journal of Organic Chemistry, 1974 , vol. 39, p. 95 - 99 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |