1-(4-phenylphenyl)-2-propan-2-yloxycarbothioylsulfanyl-ethanone
Modify Date: 2024-09-23 13:27:23
1-(4-phenylphenyl)-2-propan-2-yloxycarbothioylsulfanyl-ethanone structure
|
Common Name | 1-(4-phenylphenyl)-2-propan-2-yloxycarbothioylsulfanyl-ethanone | ||
|---|---|---|---|---|
| CAS Number | 42574-09-4 | Molecular Weight | 330.46400 | |
| Density | 1.188g/cm3 | Boiling Point | 479.1ºC at 760 mmHg | |
| Molecular Formula | C18H18O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.5ºC | |
| Name | O-propan-2-yl [2-oxo-2-(4-phenylphenyl)ethyl]sulfanylmethanethioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.188g/cm3 |
|---|---|
| Boiling Point | 479.1ºC at 760 mmHg |
| Molecular Formula | C18H18O2S2 |
| Molecular Weight | 330.46400 |
| Flash Point | 243.5ºC |
| Exact Mass | 330.07500 |
| PSA | 83.69000 |
| LogP | 4.97940 |
| Index of Refraction | 1.61 |
| InChIKey | KJEAREBGAZHABP-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=S)SCC(=O)c1ccc(-c2ccccc2)cc1 |
|
~%
1-(4-phenylphen... CAS#:42574-09-4 |
| Literature: Bhattacharya,A.K.; Hortmann,A.G. Journal of Organic Chemistry, 1974 , vol. 39, p. 95 - 99 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| O-Isopropyl-S-(p-phenylphenacyl)-dithiocarbonat |