2-[5-(2,5-dihydroxyphenyl)pentyl]benzene-1,4-diol structure
|
Common Name | 2-[5-(2,5-dihydroxyphenyl)pentyl]benzene-1,4-diol | ||
|---|---|---|---|---|
| CAS Number | 4250-92-4 | Molecular Weight | 288.33800 | |
| Density | 1.274g/cm3 | Boiling Point | 554ºC at 760 mmHg | |
| Molecular Formula | C17H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 265.4ºC | |
| Name | 2-[5-(2,5-dihydroxyphenyl)pentyl]benzene-1,4-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.274g/cm3 |
|---|---|
| Boiling Point | 554ºC at 760 mmHg |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.33800 |
| Flash Point | 265.4ºC |
| Exact Mass | 288.13600 |
| PSA | 80.92000 |
| LogP | 3.46450 |
| Index of Refraction | 1.642 |
| InChIKey | LIOHXZJMSITSBJ-UHFFFAOYSA-N |
| SMILES | Oc1ccc(O)c(CCCCCc2cc(O)ccc2O)c1 |
| HS Code | 2907299090 |
|---|
|
~%
2-[5-(2,5-dihyd... CAS#:4250-92-4 |
| Literature: Huenig, Siegfried; Sinzger, Klaus; Kemmer, Martina; Langohr, Uwe; Rieder, Herald; et al. European Journal of Organic Chemistry, 1998 , # 9 p. 1977 - 1988 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| 2,2'-pentane-1,5-diyldibenzene-1,4-diol |