tert-butyl-bis(trimethylsilyl)phosphane structure
|
Common Name | tert-butyl-bis(trimethylsilyl)phosphane | ||
|---|---|---|---|---|
| CAS Number | 42491-33-8 | Molecular Weight | 234.46600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H27PSi2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl-bis(trimethylsilyl)phosphane |
|---|
| Molecular Formula | C10H27PSi2 |
|---|---|
| Molecular Weight | 234.46600 |
| Exact Mass | 234.13900 |
| PSA | 13.59000 |
| LogP | 4.93660 |
| InChIKey | ZRCWXWUJAZXNPP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)P([Si](C)(C)C)[Si](C)(C)C |
| HS Code | 2931900090 |
|---|
|
~%
tert-butyl-bis(... CAS#:42491-33-8 |
| Literature: Schumann, Herbert; Meissner, Manfred Zeitschrift fuer Naturforschung, Teil B: Anorganische Chemie, Organische Chemie, 1980 , vol. 35, # 5 p. 594 - 598 |
| Precursor 2 | |
|---|---|
| DownStream 8 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |