4-(2,4-dichlorophenoxy)-2-methyl-1-nitrobenzene
Modify Date: 2025-09-28 22:07:13
4-(2,4-dichlorophenoxy)-2-methyl-1-nitrobenzene structure
|
Common Name | 4-(2,4-dichlorophenoxy)-2-methyl-1-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 42488-57-3 | Molecular Weight | 578.22800 | |
| Density | 1.405g/cm3 | Boiling Point | 368.5ºC at 760mmHg | |
| Molecular Formula | C26H16Cl4N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.7ºC | |
| Name | 4-(2,4-dichlorophenoxy)-2-methyl-1-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.405g/cm3 |
|---|---|
| Boiling Point | 368.5ºC at 760mmHg |
| Molecular Formula | C26H16Cl4N2O5 |
| Molecular Weight | 578.22800 |
| Flash Point | 176.7ºC |
| Exact Mass | 575.98100 |
| PSA | 100.87000 |
| LogP | 10.90610 |
| Index of Refraction | 1.613 |
| InChIKey | GYEPXYRUTLZDIO-UHFFFAOYSA-N |
| SMILES | Cc1cc(Oc2ccc(Cl)cc2Cl)ccc1[N+](=O)[O-] |
| HS Code | 2909309090 |
|---|
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2,4-dichloro-3'-methyl-4'-nitrodiphenyl ether |
| 2,4-dichloro-1-(3-methyl-4-nitrophenoxy)benzene |
| 2,4-Dichlor-3'-methyl-4'-nitro-diphenylether |