1,4-bis-(Acetoacetamido)-2,5-dichlorobenzene structure
|
Common Name | 1,4-bis-(Acetoacetamido)-2,5-dichlorobenzene | ||
|---|---|---|---|---|
| CAS Number | 42487-09-2 | Molecular Weight | 345.17800 | |
| Density | 1.439 | Boiling Point | 586.5ºC at 760mmHg | |
| Molecular Formula | C14H14Cl2N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N,N'-(2,5-Dichloro-1,4-phenylene)bis(3-oxobutanamide) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.439 |
|---|---|
| Boiling Point | 586.5ºC at 760mmHg |
| Molecular Formula | C14H14Cl2N2O4 |
| Molecular Weight | 345.17800 |
| Exact Mass | 344.03300 |
| PSA | 92.34000 |
| LogP | 2.97460 |
| Index of Refraction | 1.61 |
| InChIKey | UTAJOMREBNYBAJ-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)Nc1cc(Cl)c(NC(=O)CC(C)=O)cc1Cl |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Diacetoacet-2,5-dichloro-1,4-phenylenediamine |
| 1,4-BISACETOACETYLAMINO-2,5-DICHLOROBENZENE |