ethyl 6-oxo-6-phenylhexanoate
Modify Date: 2025-09-27 15:12:10
ethyl 6-oxo-6-phenylhexanoate structure
|
Common Name | ethyl 6-oxo-6-phenylhexanoate | ||
|---|---|---|---|---|
| CAS Number | 4248-25-3 | Molecular Weight | 234.29100 | |
| Density | 1.048g/cm3 | Boiling Point | 338.7ºC at 760 mmHg | |
| Molecular Formula | C14H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147ºC | |
| Name | ethyl 6-oxo-6-phenylhexanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.048g/cm3 |
|---|---|
| Boiling Point | 338.7ºC at 760 mmHg |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29100 |
| Flash Point | 147ºC |
| Exact Mass | 234.12600 |
| PSA | 43.37000 |
| LogP | 2.99280 |
| Index of Refraction | 1.501 |
| InChIKey | ODRIXXZKVYCRTE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCCCC(=O)c1ccccc1 |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 6-oxo-6-phenyl-hexanoic acid ethyl ester |
| 5-benzoylvaleric acid ethyl ester |
| 6-Oxo-6-phenyl-hexansaeure-aethylester |