2-(2,6-dichlorophenyl)butanedioic acid
Modify Date: 2025-09-12 20:23:33
2-(2,6-dichlorophenyl)butanedioic acid structure
|
Common Name | 2-(2,6-dichlorophenyl)butanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 42474-07-7 | Molecular Weight | 263.07400 | |
| Density | 1.555g/cm3 | Boiling Point | 362ºC at 760 mmHg | |
| Molecular Formula | C10H8Cl2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.7ºC | |
| Name | 2-(2,6-dichlorophenyl)butanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.555g/cm3 |
|---|---|
| Boiling Point | 362ºC at 760 mmHg |
| Molecular Formula | C10H8Cl2O4 |
| Molecular Weight | 263.07400 |
| Flash Point | 172.7ºC |
| Exact Mass | 261.98000 |
| PSA | 74.60000 |
| LogP | 2.63630 |
| Index of Refraction | 1.601 |
| InChIKey | PHMXFQRRTUUZJD-UHFFFAOYSA-N |
| SMILES | O=C(O)CC(C(=O)O)c1c(Cl)cccc1Cl |
| HS Code | 2917399090 |
|---|
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2,6-DIMETHYL-4-PHENYL-1,4-DIHYDROPYRIDINE-3,5-DICARBOHYDRAZIDE |
| 2-[2,6-bis(chloranyl)phenyl]butanedioic acid |
| AB1387 |
| Butanedioic acid,2-(2,6-dichlorophenyl) |
| 2-(2,6-Dichlorphenyl)-bernsteinsaeure |
| 2-(2,6-dichlorophenyl)succinic acid |