2-[[2,6-dinitro-4-(trifluoromethyl)phenyl]propylamino]ethanol structure
|
Common Name | 2-[[2,6-dinitro-4-(trifluoromethyl)phenyl]propylamino]ethanol | ||
|---|---|---|---|---|
| CAS Number | 42452-55-1 | Molecular Weight | 337.25200 | |
| Density | 1.455g/cm3 | Boiling Point | 409.2ºC at 760 mmHg | |
| Molecular Formula | C12H14F3N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.2ºC | |
| Name | 2-[2,6-dinitro-N-propyl-4-(trifluoromethyl)anilino]ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.455g/cm3 |
|---|---|
| Boiling Point | 409.2ºC at 760 mmHg |
| Molecular Formula | C12H14F3N3O5 |
| Molecular Weight | 337.25200 |
| Flash Point | 201.2ºC |
| Exact Mass | 337.08900 |
| PSA | 115.11000 |
| LogP | 3.77690 |
| Index of Refraction | 1.552 |
| InChIKey | BXCXWQRPMVCUKU-UHFFFAOYSA-N |
| SMILES | CCCN(CCO)c1c([N+](=O)[O-])cc(C(F)(F)F)cc1[N+](=O)[O-] |
| HS Code | 2922199090 |
|---|
|
~75%
2-[[2,6-dinitro... CAS#:42452-55-1 |
| Literature: Esteves; Fragiadaki; Lopes; Scoulica; Cruz Bioorganic and Medicinal Chemistry, 2010 , vol. 18, # 1 p. 274 - 281 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| einecs 255-831-3 |