2-methylprop-2-enoyloxymethyl 2-methylprop-2-enoate structure
|
Common Name | 2-methylprop-2-enoyloxymethyl 2-methylprop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 4245-38-9 | Molecular Weight | 184.18900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methylprop-2-enoyloxymethyl 2-methylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H12O4 |
|---|---|
| Molecular Weight | 184.18900 |
| Exact Mass | 184.07400 |
| PSA | 52.60000 |
| LogP | 1.18250 |
| InChIKey | ZHESMCIWZWYNLC-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OCOC(=O)C(=C)C |
| HS Code | 2916190090 |
|---|
|
~70%
2-methylprop-2-... CAS#:4245-38-9 |
| Literature: Nycomed Imaging AS Patent: US5674468 A1, 1997 ; |
|
~%
2-methylprop-2-... CAS#:4245-38-9 |
| Literature: Du Pont De Nemours and Co. Patent: US2341334 , 1941 ; |
| HS Code | 2916190090 |
|---|---|
| Summary | 2916190090 unsaturated acyclic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| Methanediol dimethacrylate |
| Bis-methacryloyloxy-methan |
| METHYLENE DIMETHACRYLATE |
| Ethylene glycol dimethacrylate |
| bis-methacryloyloxy-methane |