2-(3H-inden-1-yl)propan-2-yl acetate structure
|
Common Name | 2-(3H-inden-1-yl)propan-2-yl acetate | ||
|---|---|---|---|---|
| CAS Number | 42447-90-5 | Molecular Weight | 216.27600 | |
| Density | 1.103g/cm3 | Boiling Point | 307.1ºC at 760mmHg | |
| Molecular Formula | C14H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 125.5ºC | |
| Name | 2-(3H-inden-1-yl)propan-2-yl acetate |
|---|
| Density | 1.103g/cm3 |
|---|---|
| Boiling Point | 307.1ºC at 760mmHg |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.27600 |
| Flash Point | 125.5ºC |
| Exact Mass | 216.11500 |
| PSA | 26.30000 |
| LogP | 2.96780 |
| Index of Refraction | 1.551 |
| InChIKey | AQCVGMNRJOFKDO-UHFFFAOYSA-N |
| SMILES | CC(=O)OC(C)(C)C1=CCc2ccccc21 |
|
~%
2-(3H-inden-1-y... CAS#:42447-90-5 |
| Literature: Thibblin, Alf Journal of the American Chemical Society, 1983 , vol. 105, # 4 p. 853 - 858 |
|
~%
2-(3H-inden-1-y... CAS#:42447-90-5 |
| Literature: Thibblin, Alf Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1986 , p. 313 - 320 |
|
~%
Detail
|
| Literature: Thibblin, Alf Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1986 , p. 313 - 320 |
| Precursor 4 | |
|---|---|
| DownStream 5 | |