6-methoxy-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid
Modify Date: 2025-10-19 15:33:36
6-methoxy-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid structure
|
Common Name | 6-methoxy-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 42400-90-8 | Molecular Weight | 330.46100 | |
| Density | 1.073g/cm3 | Boiling Point | 468.3ºC at 760 mmHg | |
| Molecular Formula | C21H30O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.1ºC | |
| Name | 11MeOCO undec acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.073g/cm3 |
|---|---|
| Boiling Point | 468.3ºC at 760 mmHg |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.46100 |
| Flash Point | 159.1ºC |
| Exact Mass | 330.21900 |
| PSA | 46.53000 |
| LogP | 4.91350 |
| Index of Refraction | 1.534 |
| InChIKey | MFQBYPXOWSXYKC-UHFFFAOYSA-N |
| SMILES | COc1cc2c(cc1C(C)C)CCC1C(C)(C(=O)O)CCCC21C |
| methyl hydrogen dodecanedioate |
| Dodecandisaeure-monomethylester |
| 12-Methoxy-13-(1(3R,16S)-16-methoxycarbonyl-17-nor-vobasan-3-yl)-ibogamin-18-carbonsaeure-methylester |
| 12-Methoxy-13-isopropyl-podocarpatrien-(C)-saeure-(15) |
| 12-methoxy-abietatrien-(8.11.13)-oic acid-(18) |
| 12-Methoxy-13-isopropyl-podocarpatrien-(8.11.13)-saeure-(15) |
| 12-methoxy-13-(1(3R,16S)-16-methoxycarbonyl-17-nor-vobasan-3-yl)-ibogamine-18-carboxylic acid methyl ester |
| monomethyl-dodecanedioate |
| Dodecanedioic acid monomethyl ester |
| epi-Voacamin |
| methyl ester of 1,12-dodecanedioic acid,dimethyl ester |
| 12-Methoxy-abietatrien-(8.11.13)-saeure-(18) |
| 12-methoxy-13-(16-methoxycarbonyl-17-nor-vobasan-3-yl)-ibogamine-18-carboxylic acid methyl ester |