vinyl perfluorovalerate structure
|
Common Name | vinyl perfluorovalerate | ||
|---|---|---|---|---|
| CAS Number | 424-37-3 | Molecular Weight | 290.08300 | |
| Density | 1.511g/cm3 | Boiling Point | 99ºC at 760mmHg | |
| Molecular Formula | C7H3F9O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 14.4ºC | |
| Name | ethenyl 2,2,3,3,4,4,5,5,5-nonafluoropentanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.511g/cm3 |
|---|---|
| Boiling Point | 99ºC at 760mmHg |
| Molecular Formula | C7H3F9O2 |
| Molecular Weight | 290.08300 |
| Flash Point | 14.4ºC |
| Exact Mass | 289.99900 |
| PSA | 26.30000 |
| LogP | 3.14130 |
| Vapour Pressure | 39mmHg at 25°C |
| Index of Refraction | 1.313 |
| InChIKey | ABKMQSRPKFUWEH-UHFFFAOYSA-N |
| SMILES | C=COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| HS Code | 2915900090 |
|---|
|
~%
vinyl perfluoro... CAS#:424-37-3 |
| Literature: Reid et al. Journal of Polymer Science, 1955 , vol. 18, p. 417,418,419 |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| nonafluoro-valeric acid vinyl ester |
| Vinyl perfluorovalerate |
| Nonafluor-valeriansaeure-vinylester |
| EINECS 207-034-7 |