3-ethyl-2,5-dimethyl-1,3-benzothiazol-3-ium structure
|
Common Name | 3-ethyl-2,5-dimethyl-1,3-benzothiazol-3-ium | ||
|---|---|---|---|---|
| CAS Number | 42379-67-9 | Molecular Weight | 192.30100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H14NS+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-ethyl-2,5-dimethyl-1,3-benzothiazol-3-ium |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H14NS+ |
|---|---|
| Molecular Weight | 192.30100 |
| Exact Mass | 192.08500 |
| PSA | 32.12000 |
| LogP | 2.82550 |
| InChIKey | NWIPHSJEVBUUIR-UHFFFAOYSA-M |
| SMILES | CC[n+]1c(C)sc2ccc(C)cc21.Cc1ccc(S(=O)(=O)[O-])cc1 |
| HS Code | 2934999090 |
|---|
|
~%
3-ethyl-2,5-dim... CAS#:42379-67-9 |
| Literature: Mistr,A. et al. Collection of Czechoslovak Chemical Communications, 1971 , vol. 36, p. 150 - 163 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| AC1L56H2 |
| Benzothiazolium,3-ethyl-2,5-dimethyl-,salt with 4-methylbenzenesulfonic acid (1:1) |
| UPUJUTOIGKMZBA-UHFFFAOYSA |
| Benzothiazolium,3-ethyl-2,5-dimethyl-,4-methylbenzenesulfonate (1:1) |
| Benzothiazolium,3-ethyl-2,5-dimethyl-,p-toluenesulfonate |
| 3-ethyl-2,5-dimethyl-benzothiazolium,toluene-4-sulfonate |
| CTK8I7175 |