1-(3-chlorophenyl)-N-[(3,4-dimethoxyphenyl)methyl]methanamine structure
|
Common Name | 1-(3-chlorophenyl)-N-[(3,4-dimethoxyphenyl)methyl]methanamine | ||
|---|---|---|---|---|
| CAS Number | 423736-96-3 | Molecular Weight | 291.77300 | |
| Density | 1.159g/cm3 | Boiling Point | 398.2ºC at 760 mmHg | |
| Molecular Formula | C16H18ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.6ºC | |
| Name | 1-(3-chlorophenyl)-N-[(3,4-dimethoxyphenyl)methyl]methanamine |
|---|
| Density | 1.159g/cm3 |
|---|---|
| Boiling Point | 398.2ºC at 760 mmHg |
| Molecular Formula | C16H18ClNO2 |
| Molecular Weight | 291.77300 |
| Flash Point | 194.6ºC |
| Exact Mass | 291.10300 |
| PSA | 30.49000 |
| LogP | 4.03790 |
| Index of Refraction | 1.566 |
| InChIKey | FCTFPEAPJBUBCW-UHFFFAOYSA-N |
| SMILES | COc1ccc(CNCc2cccc(Cl)c2)cc1OC |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |