6-hydroxy-2-(3-methoxypropyl)-5-[(4-nitrophenyl)azo]-1H-benz[de]isoquinoline-1,3(2H)-dione structure
|
Common Name | 6-hydroxy-2-(3-methoxypropyl)-5-[(4-nitrophenyl)azo]-1H-benz[de]isoquinoline-1,3(2H)-dione | ||
|---|---|---|---|---|
| CAS Number | 42358-42-9 | Molecular Weight | 434.40200 | |
| Density | 1.47g/cm3 | Boiling Point | 695.902ºC at 760 mmHg | |
| Molecular Formula | C22H18N4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 374.668ºC | |
| Name | (5Z)-2-(3-methoxypropyl)-5-[(4-nitrophenyl)hydrazinylidene]benzo[de]isoquinoline-1,3,6-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.47g/cm3 |
|---|---|
| Boiling Point | 695.902ºC at 760 mmHg |
| Molecular Formula | C22H18N4O6 |
| Molecular Weight | 434.40200 |
| Flash Point | 374.668ºC |
| Exact Mass | 434.12300 |
| PSA | 135.58000 |
| LogP | 2.17100 |
| Index of Refraction | 1.692 |
| InChIKey | FMSAPXJGDRQBQW-UHFFFAOYSA-N |
| SMILES | COCCCN1C(=O)c2cccc3c(O)c(N=Nc4ccc([N+](=O)[O-])cc4)cc(c23)C1=O |
|
~66%
6-hydroxy-2-(3-... CAS#:42358-42-9 |
| Literature: Parvizi; Khosravi; Moradian; Gharanjig Journal of the Chinese Chemical Society, 2009 , vol. 56, # 5 p. 1035 - 1042 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4-Hydroxy-3-(4-nitrophenylazo)-N-(3-methoxypropyl)-1,8-naphthalenedicarboximide |
| 1H-Benz(de)isoquinoline-1,3(2H)-dione,6-hydroxy-2-(3-methoxypropyl)-5-(2-(4-nitrophenyl)diazenyl) |
| EINECS 255-774-4 |
| 1H-Benz(de)isoquinoline-1,3(2H)-dione,6-hydroxy-2-(3-methoxypropyl)-5-((4-nitrophenyl)azo) |
| 6-Hydroxy-2-(3-methoxypropyl)-5-((4-nitrophenyl)azo)-1H-benz(de)isoquinoline-1,3(2H)-dione |