3-(3-chlorophenyl)imidazolidine-2,4-dione structure
|
Common Name | 3-(3-chlorophenyl)imidazolidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 42351-76-8 | Molecular Weight | 210.61700 | |
| Density | 1.453g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H7ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(3-chlorophenyl)imidazolidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.453g/cm3 |
|---|---|
| Molecular Formula | C9H7ClN2O2 |
| Molecular Weight | 210.61700 |
| Exact Mass | 210.02000 |
| PSA | 49.41000 |
| LogP | 1.79000 |
| Index of Refraction | 1.611 |
| InChIKey | MNKDIKHHWCYCOJ-UHFFFAOYSA-N |
| SMILES | O=C1CNC(=O)N1c1cccc(Cl)c1 |
|
~%
3-(3-chlorophen... CAS#:42351-76-8 |
| Literature: Kwon, Byoung, M.; Kim, Suk Choong Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1983 , p. 761 - 764 |
|
~%
3-(3-chlorophen... CAS#:42351-76-8 |
| Literature: Cegan, Alexandr; Vecera, Miroslav Collection of Czechoslovak Chemical Communications, 1984 , vol. 49, # 6 p. 1521 - 1528 |
| 2,4-imidazolidinedione,3-(3-chlorophenyl) |
| 3-(m-Chlor-phenyl)-imidazolin-2,4-dion |
| 3-(m-Chlorphenyl)-hydantoin |
| 3-(3-chloro-phenyl)-imidazolidine-2,4-dione |