7-bromo-4,5,6-trichloro-2-(trifluoromethyl)-1H-benzimidazole
Modify Date: 2024-09-11 17:36:03
7-bromo-4,5,6-trichloro-2-(trifluoromethyl)-1H-benzimidazole structure
|
Common Name | 7-bromo-4,5,6-trichloro-2-(trifluoromethyl)-1H-benzimidazole | ||
|---|---|---|---|---|
| CAS Number | 4228-93-7 | Molecular Weight | 368.36500 | |
| Density | 2.039g/cm3 | Boiling Point | 418.5ºC at 760 mmHg | |
| Molecular Formula | C8HBrCl3F3N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.9ºC | |
| Name | 7-bromo-4,5,6-trichloro-2-(trifluoromethyl)-1H-benzimidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 2.039g/cm3 |
|---|---|
| Boiling Point | 418.5ºC at 760 mmHg |
| Molecular Formula | C8HBrCl3F3N2 |
| Molecular Weight | 368.36500 |
| Flash Point | 206.9ºC |
| Exact Mass | 365.83400 |
| PSA | 28.68000 |
| LogP | 5.30440 |
| Index of Refraction | 1.626 |
| InChIKey | KMFHVMJKOGJJRE-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1nc2c(Cl)c(Cl)c(Cl)c(Br)c2[nH]1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Brom-5,6,7-trichlor-2-trifluormethylbenzimidazol |