Acetamide,2,2-dichloro-N,N-bis(2-methylpropyl)-
Modify Date: 2025-09-23 18:11:36
Acetamide,2,2-dichloro-N,N-bis(2-methylpropyl)- structure
|
Common Name | Acetamide,2,2-dichloro-N,N-bis(2-methylpropyl)- | ||
|---|---|---|---|---|
| CAS Number | 42276-93-7 | Molecular Weight | 240.17000 | |
| Density | 1.082g/cm3 | Boiling Point | 280.6ºC at 760mmHg | |
| Molecular Formula | C10H19Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 123.5ºC | |
| Name | 2,2-dichloro-N,N-bis(2-methylpropyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.082g/cm3 |
|---|---|
| Boiling Point | 280.6ºC at 760mmHg |
| Molecular Formula | C10H19Cl2NO |
| Molecular Weight | 240.17000 |
| Flash Point | 123.5ºC |
| Exact Mass | 239.08400 |
| PSA | 20.31000 |
| LogP | 2.93070 |
| Index of Refraction | 1.468 |
| InChIKey | LKYFZECIPHDWQK-UHFFFAOYSA-N |
| SMILES | CC(C)CN(CC(C)C)C(=O)C(Cl)Cl |
| HS Code | 2924199090 |
|---|
|
~%
Acetamide,2,2-d... CAS#:42276-93-7 |
| Literature: Swensen; Weaver Journal of the American Chemical Society, 1948 , vol. 70, p. 4060 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Dichlor-essigsaeure-diisobutylamid |
| dichloro-acetic acid diisobutylamide |
| N.N-Diisobutyl-dichloracetamid |