2-benzyl-4,4-dimethyl-naphthalen-1-one structure
|
Common Name | 2-benzyl-4,4-dimethyl-naphthalen-1-one | ||
|---|---|---|---|---|
| CAS Number | 42262-37-3 | Molecular Weight | 262.34600 | |
| Density | 1.089g/cm3 | Boiling Point | 407.1ºC at 760 mmHg | |
| Molecular Formula | C19H18O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.4ºC | |
| Name | 2-benzyl-4,4-dimethylnaphthalen-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.089g/cm3 |
|---|---|
| Boiling Point | 407.1ºC at 760 mmHg |
| Molecular Formula | C19H18O |
| Molecular Weight | 262.34600 |
| Flash Point | 177.4ºC |
| Exact Mass | 262.13600 |
| PSA | 17.07000 |
| LogP | 4.32960 |
| Index of Refraction | 1.59 |
| InChIKey | WAQYTHYDVRWTDW-UHFFFAOYSA-N |
| SMILES | CC1(C)C=C(Cc2ccccc2)C(=O)c2ccccc21 |
|
~%
2-benzyl-4,4-di... CAS#:42262-37-3 |
| Literature: Hassner; Cromwell Journal of the American Chemical Society, 1958 , vol. 80, p. 893,896 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 1-Oxo-2-benzyl-4,4-dimethyl-1,4-dihydro-naphthalin |
| 2-benzyl-4,4-dimethyl-4H-naphthalen-1-one |
| 2-Benzyl-1,4-dihydro-4,4-dimethyl-1-ketonaphthalin |
| 2-Benzyl-4,4-dimethyl-4H-naphthalin-1-on |
| 1-Oxo-4,4-dimethyl-2-benzyl-1,4-dihydro-naphthalin |
| 4,4-Dimethyl-2-benzyl-1-keto-1,4-dihydro-naphthalin |
| 2-Benzyl-4,4-dimethyl-1-keto-1,4-dihydro-naphthalin |