dichloromethyl(1,1,2,2-tetrafluoroethyl)silane
Modify Date: 2025-09-01 16:08:22
dichloromethyl(1,1,2,2-tetrafluoroethyl)silane structure
|
Common Name | dichloromethyl(1,1,2,2-tetrafluoroethyl)silane | ||
|---|---|---|---|---|
| CAS Number | 422-69-5 | Molecular Weight | 215.04900 | |
| Density | 1.354g/cm3 | Boiling Point | 83.3ºC at 760mmHg | |
| Molecular Formula | C3H4Cl2F4Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 4.2ºC | |
| Name | dichloro-methyl-(1,1,2,2-tetrafluoroethyl)silane |
|---|
| Density | 1.354g/cm3 |
|---|---|
| Boiling Point | 83.3ºC at 760mmHg |
| Molecular Formula | C3H4Cl2F4Si |
| Molecular Weight | 215.04900 |
| Flash Point | 4.2ºC |
| Exact Mass | 213.94000 |
| LogP | 3.39550 |
| Vapour Pressure | 84.4mmHg at 25°C |
| Index of Refraction | 1.358 |
| InChIKey | DNTIELRTZGGEAE-UHFFFAOYSA-N |
| SMILES | C[Si](Cl)(Cl)C(F)(F)C(F)F |
| HS Code | 2931900090 |
|---|
|
~%
dichloromethyl(... CAS#:422-69-5 |
| Literature: Geyer; Haszeldine Journal of the Chemical Society, 1957 , p. 3925 |
|
~%
dichloromethyl(... CAS#:422-69-5 |
| Literature: Petrow et al. Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, 1957 , p. 1206,1212;engl.Ausg.S.1230,1236 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |