4-butyl-2,5-dihydro-5-oxo-1,2-diphenyl-1H-pyrazol-3-yl 2-(acetyloxy)benzoate
Modify Date: 2025-09-21 17:45:58
4-butyl-2,5-dihydro-5-oxo-1,2-diphenyl-1H-pyrazol-3-yl 2-(acetyloxy)benzoate structure
|
Common Name | 4-butyl-2,5-dihydro-5-oxo-1,2-diphenyl-1H-pyrazol-3-yl 2-(acetyloxy)benzoate | ||
|---|---|---|---|---|
| CAS Number | 42177-40-2 | Molecular Weight | 470.51600 | |
| Density | 1.27g/cm3 | Boiling Point | 596.8ºC at 760mmHg | |
| Molecular Formula | C28H26N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 314.7ºC | |
| Name | (4-butyl-5-oxo-1,2-diphenylpyrazol-3-yl) 2-acetyloxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 596.8ºC at 760mmHg |
| Molecular Formula | C28H26N2O5 |
| Molecular Weight | 470.51600 |
| Flash Point | 314.7ºC |
| Exact Mass | 470.18400 |
| PSA | 79.53000 |
| LogP | 5.11530 |
| Index of Refraction | 1.614 |
| InChIKey | BLQFPOWOBDISTQ-UHFFFAOYSA-N |
| SMILES | CCCCc1c(OC(=O)c2ccccc2OC(C)=O)n(-c2ccccc2)n(-c2ccccc2)c1=O |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-acetoxy-benzoic acid 4-butyl-5-oxo-1,2-diphenyl-2,5-dihydro-1H-pyrazol-3-yl ester |
| EINECS 255-697-6 |