N-[1-(3,4-dichlorophenyl)propyl]-2-(diethylamino)acetamide
Modify Date: 2025-08-26 09:17:28
![N-[1-(3,4-dichlorophenyl)propyl]-2-(diethylamino)acetamide Structure](https://image.chemsrc.com/caspic/279/42176-43-2.png)
N-[1-(3,4-dichlorophenyl)propyl]-2-(diethylamino)acetamide structure
|
Common Name | N-[1-(3,4-dichlorophenyl)propyl]-2-(diethylamino)acetamide | ||
|---|---|---|---|---|
| CAS Number | 42176-43-2 | Molecular Weight | 317.25400 | |
| Density | 1.15g/cm3 | Boiling Point | 449.8ºC at 760 mmHg | |
| Molecular Formula | C15H22Cl2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.8ºC | |
| Name | N-[1-(3,4-dichlorophenyl)propyl]-2-(diethylamino)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 449.8ºC at 760 mmHg |
| Molecular Formula | C15H22Cl2N2O |
| Molecular Weight | 317.25400 |
| Flash Point | 225.8ºC |
| Exact Mass | 316.11100 |
| PSA | 35.83000 |
| LogP | 4.74280 |
| Index of Refraction | 1.531 |
| InChIKey | BYEXFDAOAUMJMV-UHFFFAOYSA-N |
| SMILES | CCC(NC(=O)CN(CC)CC)c1ccc(Cl)c(Cl)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| ls-8915 |