2-hydroxy-1-methyl-2,4,5-triphenylpyrrol-3-one structure
|
Common Name | 2-hydroxy-1-methyl-2,4,5-triphenylpyrrol-3-one | ||
|---|---|---|---|---|
| CAS Number | 42171-92-6 | Molecular Weight | 341.40200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-hydroxy-1-methyl-2,4,5-triphenylpyrrol-3-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H19NO2 |
|---|---|
| Molecular Weight | 341.40200 |
| Exact Mass | 341.14200 |
| PSA | 40.54000 |
| LogP | 3.85260 |
| InChIKey | KFKDBIZMFLLWNI-UHFFFAOYSA-N |
| SMILES | CN1C(c2ccccc2)=C(c2ccccc2)C(=O)C1(O)c1ccccc1 |
|
~%
2-hydroxy-1-met... CAS#:42171-92-6 |
| Literature: Yoshida, Hiroshi; Bando, Shoichi; Nakajima, Shosuke; Ogata, Tsuyoshi; Matsumoto, Kiyoshi Bulletin of the Chemical Society of Japan, 1984 , vol. 57, # 9 p. 2677 - 2678 |
| 2-hydroxy-1-methyl-2,4,5-triphenyl-1,2-dihydro-pyrrol-3-one |
| 3H-Pyrrol-3-one,1,2-dihydro-2-hydroxy-1-methyl-2,4,5-triphenyl |
| 5-Hydroxy-1-methyl-2,3,5-triphenyl-2-pyrrolin-4-on |