Acetamide,2-chloro-N-[2-(1,1-dimethylethyl)- 6-methylphenyl]-N-(methoxymethyl)- structure
|
Common Name | Acetamide,2-chloro-N-[2-(1,1-dimethylethyl)- 6-methylphenyl]-N-(methoxymethyl)- | ||
|---|---|---|---|---|
| CAS Number | 4212-91-3 | Molecular Weight | 283.79400 | |
| Density | 1.098g/cm3 | Boiling Point | 389.8ºC at 760 mmHg | |
| Molecular Formula | C15H22ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.6ºC | |
| Name | N-(2-tert-butyl-6-methylphenyl)-2-chloro-N-(methoxymethyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.098g/cm3 |
|---|---|
| Boiling Point | 389.8ºC at 760 mmHg |
| Molecular Formula | C15H22ClNO2 |
| Molecular Weight | 283.79400 |
| Flash Point | 189.6ºC |
| Exact Mass | 283.13400 |
| PSA | 29.54000 |
| LogP | 3.46820 |
| Index of Refraction | 1.529 |
| InChIKey | PPUALAMAMSBQSI-UHFFFAOYSA-N |
| SMILES | COCN(C(=O)CCl)c1c(C)cccc1C(C)(C)C |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-chloro-N-methoxymethyl-2'-t-butyl-6'-methylacetanilide |