5-nitro-2-piperidin-1-ylbenzoic acid structure
|
Common Name | 5-nitro-2-piperidin-1-ylbenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 42106-50-3 | Molecular Weight | 250.25100 | |
| Density | 1.344g/cm3 | Boiling Point | 455.3ºC at 760 mmHg | |
| Molecular Formula | C12H14N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.2ºC | |
| Name | 5-nitro-2-piperidin-1-ylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.344g/cm3 |
|---|---|
| Boiling Point | 455.3ºC at 760 mmHg |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25100 |
| Flash Point | 229.2ºC |
| Exact Mass | 250.09500 |
| PSA | 86.36000 |
| LogP | 2.87150 |
| Index of Refraction | 1.61 |
| InChIKey | BJFMTEPHRNENIO-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc([N+](=O)[O-])ccc1N1CCCCC1 |
| HS Code | 2933399090 |
|---|
|
~89%
5-nitro-2-piper... CAS#:42106-50-3 |
| Literature: Docampo, Maite L.; Pellon, Rolando F.; Estevez-Braun, Ana; Ravelo, Angel G. European Journal of Organic Chemistry, 2007 , # 24 p. 4111 - 4115 |
|
~30%
5-nitro-2-piper... CAS#:42106-50-3 |
| Literature: Moehrle; Busch Archiv der Pharmazie, 1982 , vol. 315, # 2 p. 119 - 131 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Piperidino-5-nitrobenzoic acid |
| 5-Nitro-2-piperidin-1-yl-benzoic acid |
| 5-nitro-2-piperidino-benzoic acid |
| 5-Nitro-2-piperidino-benzoesaeure |