1,2,4-trifluoro-3-nitrobenzene structure
|
Common Name | 1,2,4-trifluoro-3-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 42096-74-2 | Molecular Weight | 177.08100 | |
| Density | 1.554g/cm3 | Boiling Point | 226.2ºC at 760mmHg | |
| Molecular Formula | C6H2F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,2,4-trifluoro-3-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.554g/cm3 |
|---|---|
| Boiling Point | 226.2ºC at 760mmHg |
| Molecular Formula | C6H2F3NO2 |
| Molecular Weight | 177.08100 |
| Exact Mass | 177.00400 |
| PSA | 45.82000 |
| LogP | 2.53530 |
| Index of Refraction | 1.487 |
| InChIKey | FJIILSCVSZJKCV-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1c(F)ccc(F)c1F |
| HS Code | 2904909090 |
|---|
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| EINECS 255-656-2 |
| Benzene,1,2,4-trifluoro-3-nitro |