N-(2,4-dimethylphenyl)-2-hydroxyimino-3-oxobutanamide
Modify Date: 2025-08-26 11:51:06
N-(2,4-dimethylphenyl)-2-hydroxyimino-3-oxobutanamide structure
|
Common Name | N-(2,4-dimethylphenyl)-2-hydroxyimino-3-oxobutanamide | ||
|---|---|---|---|---|
| CAS Number | 42056-96-2 | Molecular Weight | 234.25100 | |
| Density | 1.19g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(2,4-dimethylphenyl)-2-hydroxyimino-3-oxobutanamide |
|---|
| Density | 1.19g/cm3 |
|---|---|
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25100 |
| Exact Mass | 234.10000 |
| PSA | 82.25000 |
| LogP | 2.31060 |
| Index of Refraction | 1.56 |
| InChIKey | MIYBFGTUDFPWFR-PKNBQFBNSA-N |
| SMILES | CC(O)=C(N=O)C(=O)Nc1ccc(C)cc1C |
| HS Code | 2928000090 |
|---|
|
~%
N-(2,4-dimethyl... CAS#:42056-96-2 |
| Literature: Naik; Trivedi; Mankad Journal of the Indian Chemical Society, 1943 , vol. 20, p. 389 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |