5-chloro-N-[2-(2,6-dimethylphenoxy)ethyl]-N-ethylpentan-1-amine,oxalic acid structure
|
Common Name | 5-chloro-N-[2-(2,6-dimethylphenoxy)ethyl]-N-ethylpentan-1-amine,oxalic acid | ||
|---|---|---|---|---|
| CAS Number | 42054-99-9 | Molecular Weight | 387.89800 | |
| Density | N/A | Boiling Point | 391.9ºC at 760mmHg | |
| Molecular Formula | C19H30ClNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.8ºC | |
| Name | 5-chloro-N-[2-(2,6-dimethylphenoxy)ethyl]-N-ethylpentan-1-amine,oxalic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 391.9ºC at 760mmHg |
|---|---|
| Molecular Formula | C19H30ClNO5 |
| Molecular Weight | 387.89800 |
| Flash Point | 190.8ºC |
| Exact Mass | 387.18100 |
| PSA | 87.07000 |
| LogP | 3.56880 |
| InChIKey | YLAFDCGNUWUPTH-UHFFFAOYSA-N |
| SMILES | CCN(CCCCCCl)CCOc1c(C)cccc1C.O=C(O)C(=O)O |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(5-Chloropentyl)-N-(2-(2,6-dimethylphenoxy)ethyl)ethylamine oxalate |
| 1-Pentylamine,5-chloro-N-ethyl-N-(2-(2,6-xylyloxy)ethyl)-,oxalate |
| 5-chloro-N-[2-(2,6-dimethylphenoxy)ethyl]-N-ethylpentan-1-amine |
| 5-Chloro-N-ethyl-N-(2-(2,6-xylyloxy)ethyl)-1-pentylamine oxalate |