Aceticacid, 2,2-dichloro-, 4-bromophenyl ester structure
|
Common Name | Aceticacid, 2,2-dichloro-, 4-bromophenyl ester | ||
|---|---|---|---|---|
| CAS Number | 42024-34-0 | Molecular Weight | 283.93400 | |
| Density | 1.706g/cm3 | Boiling Point | 300.7ºC at 760mmHg | |
| Molecular Formula | C8H5BrCl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 135.7ºC | |
| Name | (4-bromophenyl) 2,2-dichloroacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.706g/cm3 |
|---|---|
| Boiling Point | 300.7ºC at 760mmHg |
| Molecular Formula | C8H5BrCl2O2 |
| Molecular Weight | 283.93400 |
| Flash Point | 135.7ºC |
| Exact Mass | 281.88500 |
| PSA | 26.30000 |
| LogP | 3.15820 |
| Index of Refraction | 1.574 |
| InChIKey | SRMTXXRYMZVZFO-UHFFFAOYSA-N |
| SMILES | O=C(Oc1ccc(Br)cc1)C(Cl)Cl |
|
~%
Aceticacid, 2,2... CAS#:42024-34-0 |
| Literature: Neuvonen, Helmi; Neuvonen, Kari Journal of the Chemical Society. Perkin Transactions 2, 1999 , # 7 p. 1497 - 1502 |
| 4-bromophenyl dichloroacetate |