2-(4-acetylphenoxy)acetohydrazide
Modify Date: 2025-09-04 09:39:17
2-(4-acetylphenoxy)acetohydrazide structure
|
Common Name | 2-(4-acetylphenoxy)acetohydrazide | ||
|---|---|---|---|---|
| CAS Number | 42018-31-5 | Molecular Weight | 208.21400 | |
| Density | 1.216g/cm3 | Boiling Point | 479.9ºC at 760 mmHg | |
| Molecular Formula | C10H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244ºC | |
| Name | 2-(4-acetylphenoxy)acetohydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.216g/cm3 |
|---|---|
| Boiling Point | 479.9ºC at 760 mmHg |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.21400 |
| Flash Point | 244ºC |
| Exact Mass | 208.08500 |
| PSA | 84.91000 |
| LogP | 1.79850 |
| Index of Refraction | 1.553 |
| InChIKey | HPOJJLGCBZTLMR-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(OCC(=O)NN)cc1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 4'-Carbazoylmethoxyacetophenone |
| ACETOPHENONE,4'-CARBAZOYLMETHOXY |
| 4-COCH3-phenoxyacetic acid hydrazide |