5-Nitro-1,2,3,4-tetrahydroisoquinoline structure
|
Common Name | 5-Nitro-1,2,3,4-tetrahydroisoquinoline | ||
|---|---|---|---|---|
| CAS Number | 41959-45-9 | Molecular Weight | 178.188 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 320.4±42.0 °C at 760 mmHg | |
| Molecular Formula | C9H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.6±27.9 °C | |
| Name | 5-Nitro-1,2,3,4-Tetrahydro-Isoquinoline Hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 320.4±42.0 °C at 760 mmHg |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.188 |
| Flash Point | 147.6±27.9 °C |
| Exact Mass | 178.074234 |
| PSA | 57.85000 |
| LogP | 1.13 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.585 |
| InChIKey | YJNKVSVKLAVIMU-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc2c1CCNC2 |
| HS Code | 2933499090 |
|---|
|
~88%
5-Nitro-1,2,3,4... CAS#:41959-45-9 |
| Literature: BUOLAMWINI, John, K, Patent: WO2004/60902 A2, 2004 ; Location in patent: Page/Page column 15 ; WO 2004/060902 A2 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Nitro-1,2,3,4-tetrahydroisoquinoline |
| Isoquinoline, 1,2,3,4-tetrahydro-5-nitro- |