2-amino-4-(3-amino-4-hydroxyphenyl)phenol
Modify Date: 2025-08-25 13:32:18
2-amino-4-(3-amino-4-hydroxyphenyl)phenol structure
|
Common Name | 2-amino-4-(3-amino-4-hydroxyphenyl)phenol | ||
|---|---|---|---|---|
| CAS Number | 4194-40-5 | Molecular Weight | 216.23600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-amino-4-(3-amino-4-hydroxyphenyl)phenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H12N2O2 |
|---|---|
| Molecular Weight | 216.23600 |
| Exact Mass | 216.09000 |
| PSA | 92.50000 |
| LogP | 3.09160 |
| InChIKey | KZLDGFZCFRXUIB-UHFFFAOYSA-N |
| SMILES | Nc1cc(-c2ccc(O)c(N)c2)ccc1O |
| HS Code | 2922199090 |
|---|
|
~52%
2-amino-4-(3-am... CAS#:4194-40-5 |
| Literature: Guieu, Samuel Synthetic Communications, 2012 , vol. 42, # 21 p. 3177 - 3186 |
|
~%
2-amino-4-(3-am... CAS#:4194-40-5 |
| Literature: Kunze Chemische Berichte, 1888 , vol. 21, p. 3333 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:93656-21-4| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3.3'-diamino-4.4'-dioxy-diphenyl |
| 3,3'-Diamino-4,4'-biphenyldiol |
| 3,3'-diamino-4,4'-dihydroxybiphenyl |
| 3,3'-diaminobiphenyl-4,4'-diol |