diethyl 2-[[2-(4-aminophenyl)acetyl]amino]pentanedioate structure
|
Common Name | diethyl 2-[[2-(4-aminophenyl)acetyl]amino]pentanedioate | ||
|---|---|---|---|---|
| CAS Number | 41934-84-3 | Molecular Weight | 336.38300 | |
| Density | 1.174g/cm3 | Boiling Point | 536.1ºC at 760 mmHg | |
| Molecular Formula | C17H24N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 278ºC | |
| Name | diethyl 2-[[2-(4-aminophenyl)acetyl]amino]pentanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.174g/cm3 |
|---|---|
| Boiling Point | 536.1ºC at 760 mmHg |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.38300 |
| Flash Point | 278ºC |
| Exact Mass | 336.16900 |
| PSA | 107.72000 |
| LogP | 2.17460 |
| Index of Refraction | 1.532 |
| InChIKey | KZNZDJFLHCYTFC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCC(NC(=O)Cc1ccc(N)cc1)C(=O)OCC |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| diethyl n-[(4-aminophenyl)acetyl]glutamate |
| diethyl 2-[2-(4-aminophenyl)ethanoylamino]pentanedioate |
| Diaethyl-N-(p-aminophenylacetyl)glutamat |