1-Oxa-8-azaspiro[4.5]decane-8-sulfonamide structure
|
Common Name | 1-Oxa-8-azaspiro[4.5]decane-8-sulfonamide | ||
|---|---|---|---|---|
| CAS Number | 4193-56-0 | Molecular Weight | 220.28900 | |
| Density | 1.37g/cm3 | Boiling Point | 394ºC at 760 mmHg | |
| Molecular Formula | C8H16N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.1ºC | |
| Name | 1-Oxa-8-azaspiro[4.5]decane-8-sulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 394ºC at 760 mmHg |
| Molecular Formula | C8H16N2O3S |
| Molecular Weight | 220.28900 |
| Flash Point | 192.1ºC |
| Exact Mass | 220.08800 |
| PSA | 81.01000 |
| LogP | 1.55390 |
| Index of Refraction | 1.575 |
| InChIKey | WBTMAOUXSOJKDI-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)N1CCC2(CCCO2)CC1 |
|
~%
1-Oxa-8-azaspir... CAS#:4193-56-0 |
| Literature: McManus,J.M. et al. Journal of Medicinal Chemistry, 1965 , vol. 8, p. 766 - 776 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Spiro<5.4>decan-3-on |
| Spiro<4.5>-decan-8-on |
| 8-Sulfamoyl-1-oxa-8-aza-spiro <4,5> decan |