2,2,2-trichloroethyl 2-ethylbutanoate
Modify Date: 2025-09-12 20:48:59
2,2,2-trichloroethyl 2-ethylbutanoate structure
|
Common Name | 2,2,2-trichloroethyl 2-ethylbutanoate | ||
|---|---|---|---|---|
| CAS Number | 4189-10-0 | Molecular Weight | 247.54700 | |
| Density | 1.246g/cm3 | Boiling Point | 297.5ºC at 760 mmHg | |
| Molecular Formula | C8H13Cl3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 116.9ºC | |
| Name | 2,2,2-trichloroethyl 2-ethylbutanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.246g/cm3 |
|---|---|
| Boiling Point | 297.5ºC at 760 mmHg |
| Molecular Formula | C8H13Cl3O2 |
| Molecular Weight | 247.54700 |
| Flash Point | 116.9ºC |
| Exact Mass | 245.99800 |
| PSA | 26.30000 |
| LogP | 3.33600 |
| Index of Refraction | 1.469 |
| InChIKey | AFGFYWOVFUGCLA-UHFFFAOYSA-N |
| SMILES | CCC(CC)C(=O)OCC(Cl)(Cl)Cl |
| HS Code | 2915900090 |
|---|
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| 2-Ethylbutyric acid,ester with trichloroethanol |
| BUTYRIC ACID,2-ETHYL-,2,2,2-TRICHLOROETHYL ESTER |
| Trichloroethyl 2-ethylbutyrate |