3,3-dichloro-4-(4-methoxyphenyl)-1-propan-2-ylazetidin-2-one structure
|
Common Name | 3,3-dichloro-4-(4-methoxyphenyl)-1-propan-2-ylazetidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 418765-66-9 | Molecular Weight | 288.17000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,3-dichloro-4-(4-methoxyphenyl)-1-propan-2-ylazetidin-2-one |
|---|
| Molecular Formula | C13H15Cl2NO2 |
|---|---|
| Molecular Weight | 288.17000 |
| Exact Mass | 287.04800 |
| PSA | 29.54000 |
| LogP | 3.09870 |
| InChIKey | SFNZVIHZYLBKRX-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2N(C(C)C)C(=O)C2(Cl)Cl)cc1 |
|
~78%
3,3-dichloro-4-... CAS#:418765-66-9 |
| Literature: Dejaegher, Yves; Mangelinckx, Sven; De Kimpe, Norbert Journal of Organic Chemistry, 2002 , vol. 67, # 7 p. 2075 - 2081 |
|
~%
3,3-dichloro-4-... CAS#:418765-66-9 |
| Literature: Dejaegher, Yves; Mangelinckx, Sven; De Kimpe, Norbert Journal of Organic Chemistry, 2002 , vol. 67, # 7 p. 2075 - 2081 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |