O4-phosphotyrosine
Modify Date: 2025-12-08 05:07:38
O4-phosphotyrosine structure
|
Common Name | O4-phosphotyrosine | ||
|---|---|---|---|---|
| CAS Number | 41863-47-2 | Molecular Weight | 261.16800 | |
| Density | 1.591 g/cm3 | Boiling Point | 521.7ºCat 760 mmHg | |
| Molecular Formula | C9H12NO6P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 269.3ºC | |
| Name | O4-phosphotyrosine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.591 g/cm3 |
|---|---|
| Boiling Point | 521.7ºCat 760 mmHg |
| Molecular Formula | C9H12NO6P |
| Molecular Weight | 261.16800 |
| Flash Point | 269.3ºC |
| Exact Mass | 261.04000 |
| PSA | 139.89000 |
| LogP | 0.81280 |
| Index of Refraction | 1.617 |
| InChIKey | DCWXELXMIBXGTH-UHFFFAOYSA-N |
| SMILES | NC(Cc1ccc(OP(=O)(O)O)cc1)C(=O)O |
| HS Code | 2931900090 |
|---|
|
~%
O4-phosphotyrosine CAS#:41863-47-2 |
| Literature: Bromilow, Richard H.; Chamberlain, Keith Pest Management Science, 2000 , vol. 56, # 4 p. 368 - 373 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:556-02-5| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| O-phospho-DL-tyrosine |
| 4-phosphonophenylalanine |
| O-phospho-DL-thyrosine |
| 2-amino-3-(4-phosphonooxyphenyl)propanoic acid |
| tyrosine phosphate |
| O(4)-phosphotyrosine |
| O-phosphonotyrosine |
| O-phosphotyrosine |
| O-phosphono-L-tyrosine |
| phospho-tyrosine |