2-bromo-1,3-dinitrobenzene structure
|
Common Name | 2-bromo-1,3-dinitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 4185-79-9 | Molecular Weight | 247.00300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H3BrN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-bromo-1,3-dinitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H3BrN2O4 |
|---|---|
| Molecular Weight | 247.00300 |
| Exact Mass | 245.92800 |
| PSA | 91.64000 |
| LogP | 3.31190 |
| InChIKey | IXKSHNVIXFVYLF-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc([N+](=O)[O-])c1Br |
| HS Code | 2904909090 |
|---|
|
~%
2-bromo-1,3-din... CAS#:4185-79-9 |
| Literature: Liedholm,B. Acta Chemica Scandinavica (1947-1973), 1971 , vol. 25, p. 106 - 112 |
|
~%
2-bromo-1,3-din... CAS#:4185-79-9 |
| Literature: Oxley, Jimmie C.; Smith, James L.; Ye, Hong; McKenney, Robert L.; Bolduc, Paul R. Journal of Physical Chemistry, 1995 , vol. 99, # 23 p. 9593 - 9602 |
| Precursor 2 | |
|---|---|
| DownStream 7 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2-bromo-1,3-dinitro-benzene |
| 1-bromo-2,6-dinitrobenzene |
| 2,6-dinitrobromobenzene |
| 1-Brom-2,6-dinitro-benzol |
| Benzene,2-bromo-1,3-dinitro |
| 2-Brom-1,3-dinitro-benzol |
| 2-Bromo-1.3-dinitrobenzol |