4,4'-(2,4,8,10-tetraoxaspiro[5.5]undecane-3,9-diyl)bis[2,6-di-tert-butylphenol]
Modify Date: 2025-09-18 12:24:42
![4,4'-(2,4,8,10-tetraoxaspiro[5.5]undecane-3,9-diyl)bis[2,6-di-tert-butylphenol] Structure](https://image.chemsrc.com/caspic/306/41715-24-6.png)
4,4'-(2,4,8,10-tetraoxaspiro[5.5]undecane-3,9-diyl)bis[2,6-di-tert-butylphenol] structure
|
Common Name | 4,4'-(2,4,8,10-tetraoxaspiro[5.5]undecane-3,9-diyl)bis[2,6-di-tert-butylphenol] | ||
|---|---|---|---|---|
| CAS Number | 41715-24-6 | Molecular Weight | 568.78400 | |
| Density | 1.12g/cm3 | Boiling Point | 587.2ºC at 760 mmHg | |
| Molecular Formula | C35H52O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 308.9ºC | |
| Name | 2,6-ditert-butyl-4-[3-(3,5-ditert-butyl-4-hydroxyphenyl)-2,4,8,10-tetraoxaspiro[5.5]undecan-9-yl]phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 587.2ºC at 760 mmHg |
| Molecular Formula | C35H52O6 |
| Molecular Weight | 568.78400 |
| Flash Point | 308.9ºC |
| Exact Mass | 568.37600 |
| PSA | 77.38000 |
| LogP | 8.06520 |
| Index of Refraction | 1.562 |
| InChIKey | PWIVQRVFDLNJPF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(C2OCC3(CO2)COC(c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)OC3)cc(C(C)(C)C)c1O |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| EINECS 255-512-9 |
| 4,4'-(2,4,8,10-tetraoxaspiro[5.5]undecane-3,9-diyl)bis[2,6-di-tert-butylphenol] |
| 3,9-bis(3,5-di-tert-butyl-4-hydroxyphenyl)spiro<5,5>-2,4,8,10-tetraoxaundecane |
| 2,6,2',6'-tetra-tert-butyl-4,4'-(2,4,8,10-tetraoxa-spiro[5.5]undecane-3,9-diyl)-bis-phenol |