6-[5-(4-bromophenyl)-1,2-dihydropyrazol-3-ylidene]cyclohexa-2,4-dien-1-one
Modify Date: 2025-09-20 18:02:23
![6-[5-(4-bromophenyl)-1,2-dihydropyrazol-3-ylidene]cyclohexa-2,4-dien-1-one Structure](https://image.chemsrc.com/caspic/117/416877-45-7.png)
6-[5-(4-bromophenyl)-1,2-dihydropyrazol-3-ylidene]cyclohexa-2,4-dien-1-one structure
|
Common Name | 6-[5-(4-bromophenyl)-1,2-dihydropyrazol-3-ylidene]cyclohexa-2,4-dien-1-one | ||
|---|---|---|---|---|
| CAS Number | 416877-45-7 | Molecular Weight | 315.16500 | |
| Density | 1.528g/cm3 | Boiling Point | 516.1ºC at 760 mmHg | |
| Molecular Formula | C15H11BrN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 265.9ºC | |
| Name | 6-[5-(4-bromophenyl)-1,2-dihydropyrazol-3-ylidene]cyclohexa-2,4-dien-1-one |
|---|
| Density | 1.528g/cm3 |
|---|---|
| Boiling Point | 516.1ºC at 760 mmHg |
| Molecular Formula | C15H11BrN2O |
| Molecular Weight | 315.16500 |
| Flash Point | 265.9ºC |
| Exact Mass | 314.00500 |
| PSA | 48.91000 |
| LogP | 4.21180 |
| Index of Refraction | 1.675 |
| InChIKey | JKSLJMHPVLYRES-UHFFFAOYSA-N |
| SMILES | Oc1ccccc1-c1cc(-c2ccc(Br)cc2)n[nH]1 |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |