chloroethene,ethenyl acetate,2-hydroxypropyl prop-2-enoate structure
|
Common Name | chloroethene,ethenyl acetate,2-hydroxypropyl prop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 41618-91-1 | Molecular Weight | 278.72900 | |
| Density | N/A | Boiling Point | 194.5ºC at 760 mmHg | |
| Molecular Formula | C12H19ClO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 79.9ºC | |
| Name | chloroethene,ethenyl acetate,2-hydroxypropyl prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 194.5ºC at 760 mmHg |
|---|---|
| Molecular Formula | C12H19ClO5 |
| Molecular Weight | 278.72900 |
| Flash Point | 79.9ºC |
| Exact Mass | 278.09200 |
| PSA | 72.83000 |
| LogP | 2.15810 |
| InChIKey | CDZRKFJZEOBIOO-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OCC(C)O.C=CCl.C=COC(C)=O |
| 2-Hydroxypropyl acrylate,copolymer with vinyl acetate and vinyl chloride |
| 2-Hydroxypropyl acrylate vinyl chloride vinyl acetate polymer |
| 2-Propenoic acid,2-hydroxypropyl ester,polymer with chloroethene and ethenyl acetate |