3-hydroxy-7-methoxy-N-phenylnaphthalene-2-carboxamide
Modify Date: 2025-08-30 16:20:21
3-hydroxy-7-methoxy-N-phenylnaphthalene-2-carboxamide structure
|
Common Name | 3-hydroxy-7-methoxy-N-phenylnaphthalene-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 41611-98-7 | Molecular Weight | 293.31700 | |
| Density | 1.304g/cm3 | Boiling Point | 426.5ºC at 760 mmHg | |
| Molecular Formula | C18H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.8ºC | |
| Name | 3-hydroxy-7-methoxy-N-phenylnaphthalene-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.304g/cm3 |
|---|---|
| Boiling Point | 426.5ºC at 760 mmHg |
| Molecular Formula | C18H15NO3 |
| Molecular Weight | 293.31700 |
| Flash Point | 211.8ºC |
| Exact Mass | 293.10500 |
| PSA | 58.56000 |
| LogP | 3.87930 |
| Index of Refraction | 1.703 |
| InChIKey | NMOUGHCHKXXTRY-UHFFFAOYSA-N |
| SMILES | COc1ccc2cc(O)c(C(=O)Nc3ccccc3)cc2c1 |
| HS Code | 2924299090 |
|---|
|
~%
3-hydroxy-7-met... CAS#:41611-98-7 |
| Literature: Gen. Aniline Works Patent: US1935930 , 1931 ; Full Text Show Details I. G. Farbenind. Patent: DE573723 , 1930 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 19, p. 785 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-hydroxy-7-methoxy-[2]naphthoic acid anilide |
| EINECS 255-461-2 |
| 3-Hydroxy-7-methoxy-[2]naphthoesaeure-anilid |
| 2-Naphthalenecarboxamide,3-hydroxy-7-methoxy-N-phenyl |
| 7-Methoxy-3-hydroxy-2-naphthanilide |
| 2-hydroxy-6-methoxy-3-naphthanilide |
| 3-hydroxy-7-methoxy-N-phenyl-naphthalene-2-carboxamide |