2-ethylsulfanyl-1,3,5-trinitrobenzene structure
|
Common Name | 2-ethylsulfanyl-1,3,5-trinitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 41577-89-3 | Molecular Weight | 273.22300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H7N3O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-ethylsulfanyl-1,3,5-trinitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H7N3O6S |
|---|---|
| Molecular Weight | 273.22300 |
| Exact Mass | 273.00600 |
| PSA | 162.76000 |
| LogP | 4.09280 |
| InChIKey | IFTYOWOQDRGUSJ-UHFFFAOYSA-N |
| SMILES | CCSc1c([N+](=O)[O-])cc([N+](=O)[O-])cc1[N+](=O)[O-] |
|
~%
2-ethylsulfanyl... CAS#:41577-89-3 |
| Literature: Culvenor et al. Journal of the Chemical Society, 1952 , p. 4480,4484 |
| Benzene,2-(ethylthio)-1,3,5-trinitro |
| ethyl-picryl sulfide |
| Aethyl-picryl-sulfid |