Methanone,[4-[2-(1-ethenyl-5-nitro-1H-imidazol-2-yl)ethenyl]phenyl]-4-morpholinyl- structure
|
Common Name | Methanone,[4-[2-(1-ethenyl-5-nitro-1H-imidazol-2-yl)ethenyl]phenyl]-4-morpholinyl- | ||
|---|---|---|---|---|
| CAS Number | 41552-68-5 | Molecular Weight | 354.36000 | |
| Density | 1.3g/cm3 | Boiling Point | 646.8ºC at 760 mmHg | |
| Molecular Formula | C18H18N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 345ºC | |
| Name | [4-[(E)-2-(1-ethenyl-5-nitroimidazol-2-yl)ethenyl]phenyl]-morpholin-4-ylmethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 646.8ºC at 760 mmHg |
| Molecular Formula | C18H18N4O4 |
| Molecular Weight | 354.36000 |
| Flash Point | 345ºC |
| Exact Mass | 354.13300 |
| PSA | 93.18000 |
| LogP | 2.99570 |
| Index of Refraction | 1.63 |
| InChIKey | QTBIGJDIHGINOK-VMPITWQZSA-N |
| SMILES | C=Cn1c([N+](=O)[O-])cnc1C=Cc1ccc(C(=O)N2CCOCC2)cc1 |
|
~%
Methanone,[4-[2... CAS#:41552-68-5 |
| Literature: Ross; Jamieson; McCowen Journal of medicinal chemistry, 1973 , vol. 16, # 4 p. 347 - 352 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-{4-[2-(5-nitro-1-vinyl-1H-imidazol-2-yl)-vinyl]-benzoyl}-morpholine |